6-(2-methylprop-2-enoyloxy)hexyl 2-methylprop-2-enoate
Catalog No: FT-0734188
CAS No: 6606-59-3
- Chemical Name: 6-(2-methylprop-2-enoyloxy)hexyl 2-methylprop-2-enoate
- Molecular Formula: C14H22O4
- Molecular Weight: 254.32
- InChI Key: SAPGBCWOQLHKKZ-UHFFFAOYSA-N
- InChI: InChI=1S/C14H22O4/c1-11(2)13(15)17-9-7-5-6-8-10-18-14(16)12(3)4/h1,3,5-10H2,2,4H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 1,6-Hexanediyl bis(2-methylacrylate) |
|---|---|
| Bolling_Point: | 334.2±25.0 °C at 760 mmHg |
| MF: | C14H22O4 |
| Symbol: | GHS07 |
| Melting_Point: | N/A |
| Density: | 1.0±0.1 g/cm3 |
| CAS: | 6606-59-3 |
| FW: | 254.322 |
| Flash_Point: | 157.3±21.6 °C |
| MF: | C14H22O4 |
|---|---|
| Refractive_Index: | 1.455 |
| Flash_Point: | 157.3±21.6 °C |
| PSA: | 52.60000 |
| Bolling_Point: | 334.2±25.0 °C at 760 mmHg |
| Density: | 1.0±0.1 g/cm3 |
| Exact_Mass: | 254.151810 |
| FW: | 254.322 |
| LogP: | 4.06 |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Risk_Statements(EU): | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed . R36/37/38:Irritating to eyes, respiratory system and skin . |
|---|---|
| Personal_Protective_Equipment: | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Safety_Statements: | H315-H319-H335 |
| HS_Code: | 2916190090 |
| WGK_Germany: | 2 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | UN 3082 9/PG 3 |
| Symbol: | GHS07 |
| Hazard_Codes: | Xn,Xi |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-